C20H27N5O — CID 168921720
[7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]methanamine (PubChem CID 168921720) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is [7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]methanamine.
| Compound Name | [7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 168921720 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | [7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]methanamine |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(CN)cc(N3CCOCC3)n2n1 |
| InChI | InChI=1S/C20H27N5O/c1-3-5-6-8-16(7-4-2)18-14-19-22-17(15-21)13-20(25(19)23-18)24-9-11-26-12-10-24/h4-8,13-14H,3,9-12,15,21H2,1-2H3/b6-5+,7-4-,16-8+ |
| InChIKey | KNWHTLBTLZDSTO-ZLTBVZKBSA-N |
| XLogP | 2.95 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|