C28H39N7O — CID 168921700
4-[5-(2-methyl-3-piperidin-3-yl-3H-pyrazol-1-yl)-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine (PubChem CID 168921700) has the molecular formula C28H39N7O and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-[5-(2-methyl-3-piperidin-3-yl-3H-pyrazol-1-yl)-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[5-(2-methyl-3-piperidin-3-yl-3H-pyrazol-1-yl)-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 168921700 |
| Molecular Formula | C28H39N7O |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 4-[5-(2-methyl-3-piperidin-3-yl-3H-pyrazol-1-yl)-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(N3C=CC(C4CCCNC4)N3C)cc(N3CCOCC3)n2n1 |
| InChI | InChI=1S/C28H39N7O/c1-4-6-7-10-22(9-5-2)24-19-27-30-26(20-28(35(27)31-24)33-15-17-36-18-16-33)34-14-12-25(32(34)3)23-11-8-13-29-21-23/h5-7,9-10,12,14,19-20,23,25,29H,4,8,11,13,15-18,21H2,1-3H3/b7-6+,9-5-,22-10+ |
| InChIKey | WXJBSTZUNMGZLJ-CHSXLJMPSA-N |
| XLogP | 4.04 |
| TPSA | 61.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|