C20H25N5O — CID 142901875
6-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-morpholin-4-yl-N-pyridin-3-ylpyrimidin-4-amine (PubChem CID 142901875) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 6-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-morpholin-4-yl-N-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 6-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-morpholin-4-yl-N-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 142901875 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 6-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-morpholin-4-yl-N-pyridin-3-ylpyrimidin-4-amine |
| SMILES | C/C=C\C(=C/CC)c1cc(Nc2cccnc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25N5O/c1-3-6-16(7-4-2)18-14-19(22-17-8-5-9-21-15-17)24-20(23-18)25-10-12-26-13-11-25/h3,5-9,14-15H,4,10-13H2,1-2H3,(H,22,23,24)/b6-3-,16-7+ |
| InChIKey | CJBHWQKNIYNVIH-BYTXJHPBSA-N |
| XLogP | 3.82 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|