C29H37N5O2 — CID 168921979
N-methyl-1-(3-methylphenyl)-2-[7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]oxyethanamine (PubChem CID 168921979) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-methyl-1-(3-methylphenyl)-2-[7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]oxyethanamine.
| Compound Name | N-methyl-1-(3-methylphenyl)-2-[7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]oxyethanamine |
|---|---|
| PubChem CID | 168921979 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-methyl-1-(3-methylphenyl)-2-[7-morpholin-4-yl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-5-yl]oxyethanamine |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(OCC(NC)c3cccc(C)c3)cc(N3CCOCC3)n2n1 |
| InChI | InChI=1S/C29H37N5O2/c1-5-7-8-12-23(10-6-2)25-19-27-31-28(20-29(34(27)32-25)33-14-16-35-17-15-33)36-21-26(30-4)24-13-9-11-22(3)18-24/h6-13,18-20,26,30H,5,14-17,21H2,1-4H3/b8-7+,10-6-,23-12+ |
| InChIKey | SSNKIFJWTGBAHS-ROWQCATDSA-N |
| XLogP | 5.14 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|