C20H24ClN3O2 — CID 166164851
2-chloro-7-methyl-4-morpholin-4-yl-6-[(4E,6Z)-nona-4,6,8-trien-4-yl]furo[3,2-d]pyrimidine (PubChem CID 166164851) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-chloro-7-methyl-4-morpholin-4-yl-6-[(4E,6Z)-nona-4,6,8-trien-4-yl]furo[3,2-d]pyrimidine.
| Compound Name | 2-chloro-7-methyl-4-morpholin-4-yl-6-[(4E,6Z)-nona-4,6,8-trien-4-yl]furo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 166164851 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-chloro-7-methyl-4-morpholin-4-yl-6-[(4E,6Z)-nona-4,6,8-trien-4-yl]furo[3,2-d]pyrimidine |
| SMILES | C=C/C=C\C=C(/CCC)c1oc2c(N3CCOCC3)nc(Cl)nc2c1C |
| InChI | InChI=1S/C20H24ClN3O2/c1-4-6-7-9-15(8-5-2)17-14(3)16-18(26-17)19(23-20(21)22-16)24-10-12-25-13-11-24/h4,6-7,9H,1,5,8,10-13H2,2-3H3/b7-6-,15-9+ |
| InChIKey | XUNFOVPPZGCPGL-KWMXLAOOSA-N |
| XLogP | 4.95 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|