C17H24ClN3O3 — CID 166164653
methyl (2E)-2-[(2-chloro-5-methyl-6-morpholin-4-ylpyrimidin-4-yl)methylidene]-3-methylpentanoate (PubChem CID 166164653) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is methyl (2E)-2-[(2-chloro-5-methyl-6-morpholin-4-ylpyrimidin-4-yl)methylidene]-3-methylpentanoate.
| Compound Name | methyl (2E)-2-[(2-chloro-5-methyl-6-morpholin-4-ylpyrimidin-4-yl)methylidene]-3-methylpentanoate |
|---|---|
| PubChem CID | 166164653 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl (2E)-2-[(2-chloro-5-methyl-6-morpholin-4-ylpyrimidin-4-yl)methylidene]-3-methylpentanoate |
| SMILES | CCC(C)/C(=C\c1nc(Cl)nc(N2CCOCC2)c1C)C(=O)OC |
| InChI | InChI=1S/C17H24ClN3O3/c1-5-11(2)13(16(22)23-4)10-14-12(3)15(20-17(18)19-14)21-6-8-24-9-7-21/h10-11H,5-9H2,1-4H3/b13-10+ |
| InChIKey | LLIMRHKKJAPFQF-JLHYYAGUSA-N |
| XLogP | 2.88 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|