C13H16BrClN6O2 — CID 86667381
2-bromo-N-[1-(2-chloro-6-morpholin-4-yl-7H-purin-8-yl)ethyl]acetamide (PubChem CID 86667381) has the molecular formula C13H16BrClN6O2 and a molecular weight of 403.67 g/mol. Its IUPAC name is 2-bromo-N-[1-(2-chloro-6-morpholin-4-yl-7H-purin-8-yl)ethyl]acetamide.
| Compound Name | 2-bromo-N-[1-(2-chloro-6-morpholin-4-yl-7H-purin-8-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 86667381 |
| Molecular Formula | C13H16BrClN6O2 |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-bromo-N-[1-(2-chloro-6-morpholin-4-yl-7H-purin-8-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CBr)c1nc2nc(Cl)nc(N3CCOCC3)c2[nH]1 |
| InChI | InChI=1S/C13H16BrClN6O2/c1-7(16-8(22)6-14)10-17-9-11(18-10)19-13(15)20-12(9)21-2-4-23-5-3-21/h7H,2-6H2,1H3,(H,16,22)(H,17,18,19,20) |
| InChIKey | MRQOHLQRAKXEOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|