About (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one
(7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one (PubChem CID 86338948) has the molecular formula C12H15ClN4O2
and a molecular weight of 282.73 g/mol. Its IUPAC name is (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one |
| PubChem CID | 86338948 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one |
| SMILES | C[C@H]1C(=O)N(C)c2c1nc(Cl)nc2N1CCOCC1 |
| InChI | InChI=1S/C12H15ClN4O2/c1-7-8-9(16(2)11(7)18)10(15-12(13)14-8)17-3-5-19-6-4-17/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | SPNJDWRCACBKJQ-SSDOTTSWSA-N |
| XLogP | 1.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one?
The IUPAC name of (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one (CID 86338948) is (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one.
What is the SMILES notation for (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one?
The canonical SMILES for (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one is C[C@H]1C(=O)N(C)c2c1nc(Cl)nc2N1CCOCC1.
What is the InChIKey of (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one?
The InChIKey is SPNJDWRCACBKJQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H15ClN4O2/c1-7-8-9(16(2)11(7)18)10(15-12(13)14-8)17-3-5-19-6-4-17/h7H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one?
(7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one has a molecular weight of 282.73 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-2-chloro-5,7-dimethyl-4-morpholin-4-yl-7H-pyrrolo[3,2-d]pyrimidin-6-one is sourced from PubChem (CID 86338948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).