C9H14N8OS2 — CID 134123670
(4-carbamimidoylsulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-yl) carbamimidothioate (PubChem CID 134123670) has the molecular formula C9H14N8OS2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (4-carbamimidoylsulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-yl) carbamimidothioate.
| Compound Name | (4-carbamimidoylsulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-yl) carbamimidothioate |
|---|---|
| PubChem CID | 134123670 |
| Molecular Formula | C9H14N8OS2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (4-carbamimidoylsulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-yl) carbamimidothioate |
| SMILES | [H]/N=C(\N)Sc1nc(S/C(N)=N/[H])nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H14N8OS2/c10-5(11)19-8-14-7(17-1-3-18-4-2-17)15-9(16-8)20-6(12)13/h1-4H2,(H3,10,11)(H3,12,13) |
| InChIKey | MOWHFEBDRCFUOO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|