C6H13N5O2 — CID 66277342
2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethoxy]ethanol (PubChem CID 66277342) has the molecular formula C6H13N5O2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66277342 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]ethoxy]ethanol |
| SMILES | Nc1nc(NCCOCCO)n[nH]1 |
| InChI | InChI=1S/C6H13N5O2/c7-5-9-6(11-10-5)8-1-3-13-4-2-12/h12H,1-4H2,(H4,7,8,9,10,11) |
| InChIKey | KXKWDHNGPWLWRU-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|