C7H13N5 — CID 106198150
3-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 106198150) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 3-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 106198150 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 3-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)=CCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C7H13N5/c1-5(2)3-4-9-7-10-6(8)11-12-7/h3H,4H2,1-2H3,(H4,8,9,10,11,12) |
| InChIKey | AFMWKHCEEOFLKL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|