C5H10N6 — CID 123531217
3-[amino(prop-2-enyl)amino]-1H-1,2,4-triazol-5-amine (PubChem CID 123531217) has the molecular formula C5H10N6 and a molecular weight of 154.18 g/mol. Its IUPAC name is 3-[amino(prop-2-enyl)amino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[amino(prop-2-enyl)amino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 123531217 |
| Molecular Formula | C5H10N6 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-[amino(prop-2-enyl)amino]-1H-1,2,4-triazol-5-amine |
| SMILES | C=CCN(N)c1n[nH]c(N)n1 |
| InChI | InChI=1S/C5H10N6/c1-2-3-11(7)5-8-4(6)9-10-5/h2H,1,3,7H2,(H3,6,8,9,10) |
| InChIKey | UVZIXBMMLNIIJA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|