C7H7ClN5OSe — CID 175413683
CID 175413683 (PubChem CID 175413683) has the molecular formula C7H7ClN5OSe and a molecular weight of 291.58 g/mol.
| Compound Name | CID 175413683 |
|---|---|
| PubChem CID | 175413683 |
| Molecular Formula | C7H7ClN5OSe |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | — |
| SMILES | COc1nc(Cl)nc(NCC([Se])C#N)n1 |
| InChI | InChI=1S/C7H7ClN5OSe/c1-14-7-12-5(8)11-6(13-7)10-3-4(15)2-9/h4H,3H2,1H3,(H,10,11,12,13) |
| InChIKey | AHRDGHOJCVVRBV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|