C8H9ClN4O — CID 114417966
N-but-3-yn-2-yl-4-chloro-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 114417966) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is N-but-3-yn-2-yl-4-chloro-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | N-but-3-yn-2-yl-4-chloro-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114417966 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | N-but-3-yn-2-yl-4-chloro-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | C#CC(C)Nc1nc(Cl)nc(OC)n1 |
| InChI | InChI=1S/C8H9ClN4O/c1-4-5(2)10-7-11-6(9)12-8(13-7)14-3/h1,5H,2-3H3,(H,10,11,12,13) |
| InChIKey | VVMZVLBLIKBSSQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|