C11H20N4O — CID 104594461
1-[2-[(4,6-dimethylpyrimidin-2-yl)amino]ethylamino]propan-2-ol (PubChem CID 104594461) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-[2-[(4,6-dimethylpyrimidin-2-yl)amino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[(4,6-dimethylpyrimidin-2-yl)amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 104594461 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-[2-[(4,6-dimethylpyrimidin-2-yl)amino]ethylamino]propan-2-ol |
| SMILES | Cc1cc(C)nc(NCCNCC(C)O)n1 |
| InChI | InChI=1S/C11H20N4O/c1-8-6-9(2)15-11(14-8)13-5-4-12-7-10(3)16/h6,10,12,16H,4-5,7H2,1-3H3,(H,13,14,15) |
| InChIKey | WMYODKOQPITGIE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|