C11H17N5O — CID 113430486
1-[2-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)ethylamino]propan-2-ol (PubChem CID 113430486) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[2-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)ethylamino]propan-2-ol.
| Compound Name | 1-[2-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 113430486 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-[2-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNc1nc2ccccn2n1 |
| InChI | InChI=1S/C11H17N5O/c1-9(17)8-12-5-6-13-11-14-10-4-2-3-7-16(10)15-11/h2-4,7,9,12,17H,5-6,8H2,1H3,(H,13,15) |
| InChIKey | BSAMGLVEVWWNAT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|