C11H15N5O — CID 106239011
5-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)pentanamide (PubChem CID 106239011) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 5-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)pentanamide.
| Compound Name | 5-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)pentanamide |
|---|---|
| PubChem CID | 106239011 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 5-([1,2,4]triazolo[1,5-a]pyridin-2-ylamino)pentanamide |
| SMILES | NC(=O)CCCCNc1nc2ccccn2n1 |
| InChI | InChI=1S/C11H15N5O/c12-9(17)5-1-3-7-13-11-14-10-6-2-4-8-16(10)15-11/h2,4,6,8H,1,3,5,7H2,(H2,12,17)(H,13,15) |
| InChIKey | DETGLELFGCHPMJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|