C11H19N3 — CID 62694170
4,6-dimethyl-N-(2-methylbutyl)pyrimidin-2-amine (PubChem CID 62694170) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 4,6-dimethyl-N-(2-methylbutyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-(2-methylbutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 62694170 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4,6-dimethyl-N-(2-methylbutyl)pyrimidin-2-amine |
| SMILES | CCC(C)CNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-5-8(2)7-12-11-13-9(3)6-10(4)14-11/h6,8H,5,7H2,1-4H3,(H,12,13,14) |
| InChIKey | RXCWTKTYYDFZNZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |