About N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine
N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine (PubChem CID 107156052) has the molecular formula C13H22ClN3
and a molecular weight of 255.79 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine |
| PubChem CID | 107156052 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCC(Cl)CC(C)(C)C)n1 |
| InChI | InChI=1S/C13H22ClN3/c1-9-6-10(2)17-12(16-9)15-8-11(14)7-13(3,4)5/h6,11H,7-8H2,1-5H3,(H,15,16,17) |
| InChIKey | IXQPZBKJYBBHMV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine?
The IUPAC name of N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine (CID 107156052) is N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine?
The canonical SMILES for N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine is Cc1cc(C)nc(NCC(Cl)CC(C)(C)C)n1.
What is the InChIKey of N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine?
The InChIKey is IXQPZBKJYBBHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22ClN3/c1-9-6-10(2)17-12(16-9)15-8-11(14)7-13(3,4)5/h6,11H,7-8H2,1-5H3,(H,15,16,17).
What are the key properties of N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine?
N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine has a molecular weight of 255.79 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 107156052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).