C13H22ClN3 — CID 107156052
N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine (PubChem CID 107156052) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 107156052 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCC(Cl)CC(C)(C)C)n1 |
| InChI | InChI=1S/C13H22ClN3/c1-9-6-10(2)17-12(16-9)15-8-11(14)7-13(3,4)5/h6,11H,7-8H2,1-5H3,(H,15,16,17) |
| InChIKey | IXQPZBKJYBBHMV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|