C15H18Cl12N6 — CID 21431084
2-N,4-N,6-N-tris(2,4,4,4-tetrachlorobutyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 21431084) has the molecular formula C15H18Cl12N6 and a molecular weight of 707.79 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(2,4,4,4-tetrachlorobutyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(2,4,4,4-tetrachlorobutyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21431084 |
| Molecular Formula | C15H18Cl12N6 |
| Molecular Weight | 707.79 g/mol |
| Exact Mass | 701.79 |
| IUPAC Name | 2-N,4-N,6-N-tris(2,4,4,4-tetrachlorobutyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | ClC(CNc1nc(NCC(Cl)CC(Cl)(Cl)Cl)nc(NCC(Cl)CC(Cl)(Cl)Cl)n1)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl12N6/c16-7(1-13(19,20)21)4-28-10-31-11(29-5-8(17)2-14(22,23)24)33-12(32-10)30-6-9(18)3-15(25,26)27/h7-9H,1-6H2,(H3,28,29,30,31,32,33) |
| InChIKey | JJVOBQHPEOFITQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.79 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|