C16H22Cl6N10O2 — CID 110178285
1-[[4-[2-[[4-(2-hydroxypropylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]propan-2-ol (PubChem CID 110178285) has the molecular formula C16H22Cl6N10O2 and a molecular weight of 599.14 g/mol. Its IUPAC name is 1-[[4-[2-[[4-(2-hydroxypropylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]propan-2-ol.
| Compound Name | 1-[[4-[2-[[4-(2-hydroxypropylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 110178285 |
| Molecular Formula | C16H22Cl6N10O2 |
| Molecular Weight | 599.14 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | 1-[[4-[2-[[4-(2-hydroxypropylamino)-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]propan-2-ol |
| SMILES | CC(O)CNc1nc(NCCNc2nc(NCC(C)O)nc(C(Cl)(Cl)Cl)n2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C16H22Cl6N10O2/c1-7(33)5-25-13-29-9(15(17,18)19)27-11(31-13)23-3-4-24-12-28-10(16(20,21)22)30-14(32-12)26-6-8(2)34/h7-8,33-34H,3-6H2,1-2H3,(H2,23,25,27,29,31)(H2,24,26,28,30,32) |
| InChIKey | BXPGQAVDUYMUHG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|