C17H28N8O — CID 134520352
(2S)-1-[[4,8-bis(ethylamino)-2-(2-methylprop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propan-2-ol (PubChem CID 134520352) has the molecular formula C17H28N8O and a molecular weight of 360.47 g/mol. Its IUPAC name is (2S)-1-[[4,8-bis(ethylamino)-2-(2-methylprop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-[[4,8-bis(ethylamino)-2-(2-methylprop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 134520352 |
| Molecular Formula | C17H28N8O |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (2S)-1-[[4,8-bis(ethylamino)-2-(2-methylprop-2-enylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]propan-2-ol |
| SMILES | C=C(C)CNc1nc(NCC)c2nc(NC[C@H](C)O)nc(NCC)c2n1 |
| InChI | InChI=1S/C17H28N8O/c1-6-18-14-13-12(22-16(24-14)20-8-10(3)4)15(19-7-2)25-17(23-13)21-9-11(5)26/h11,26H,3,6-9H2,1-2,4-5H3,(H2,18,20,22,24)(H2,19,21,23,25)/t11-/m0/s1 |
| InChIKey | KDUUEGPKWLDKLN-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|