About 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol
1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol (PubChem CID 104594238) has the molecular formula C8H14BrN3OS
and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol |
| PubChem CID | 104594238 |
| Molecular Formula | C8H14BrN3OS |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNc1nc(Br)cs1 |
| InChI | InChI=1S/C8H14BrN3OS/c1-6(13)4-10-2-3-11-8-12-7(9)5-14-8/h5-6,10,13H,2-4H2,1H3,(H,11,12) |
| InChIKey | OFOKXTLUIPLAKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol?
The IUPAC name of 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol (CID 104594238) is 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol.
What is the SMILES notation for 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol?
The canonical SMILES for 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol is CC(O)CNCCNc1nc(Br)cs1.
What is the InChIKey of 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol?
The InChIKey is OFOKXTLUIPLAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrN3OS/c1-6(13)4-10-2-3-11-8-12-7(9)5-14-8/h5-6,10,13H,2-4H2,1H3,(H,11,12).
What are the key properties of 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol?
1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol has a molecular weight of 280.19 g/mol, XLogP of 1.29, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol is sourced from PubChem (CID 104594238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).