C8H14BrN3OS — CID 104594238
1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol (PubChem CID 104594238) has the molecular formula C8H14BrN3OS and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 104594238 |
| Molecular Formula | C8H14BrN3OS |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 1-[2-[(4-bromo-1,3-thiazol-2-yl)amino]ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNc1nc(Br)cs1 |
| InChI | InChI=1S/C8H14BrN3OS/c1-6(13)4-10-2-3-11-8-12-7(9)5-14-8/h5-6,10,13H,2-4H2,1H3,(H,11,12) |
| InChIKey | OFOKXTLUIPLAKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|