About 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide
1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide (PubChem CID 131097829) has the molecular formula C6H10BrN3O2S2
and a molecular weight of 300.20 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide.
Molecular Properties
| Compound Name | 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide |
| PubChem CID | 131097829 |
| Molecular Formula | C6H10BrN3O2S2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide |
| SMILES | CC(CNc1nc(Br)cs1)S(N)(=O)=O |
| InChI | InChI=1S/C6H10BrN3O2S2/c1-4(14(8,11)12)2-9-6-10-5(7)3-13-6/h3-4H,2H2,1H3,(H,9,10)(H2,8,11,12) |
| InChIKey | UCOJVMYTXFJBHT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide?
The IUPAC name of 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide (CID 131097829) is 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide.
What is the SMILES notation for 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide?
The canonical SMILES for 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide is CC(CNc1nc(Br)cs1)S(N)(=O)=O.
What is the InChIKey of 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide?
The InChIKey is UCOJVMYTXFJBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrN3O2S2/c1-4(14(8,11)12)2-9-6-10-5(7)3-13-6/h3-4H,2H2,1H3,(H,9,10)(H2,8,11,12).
What are the key properties of 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide?
1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide has a molecular weight of 300.20 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-1,3-thiazol-2-yl)amino]propane-2-sulfonamide is sourced from PubChem (CID 131097829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).