C7H9BrN2O2S — CID 79398752
methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate (PubChem CID 79398752) has the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. Its IUPAC name is methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate.
| Compound Name | methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 79398752 |
| Molecular Formula | C7H9BrN2O2S |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)C(C)Nc1nc(Br)cs1 |
| InChI | InChI=1S/C7H9BrN2O2S/c1-4(6(11)12-2)9-7-10-5(8)3-13-7/h3-4H,1-2H3,(H,9,10) |
| InChIKey | PIQMEDPNZNJVJU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |