methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate

C7H9BrN2O2S — CID 79398752

IUPACmethyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate
SMILESCOC(=O)C(C)Nc1nc(Br)cs1
InChIInChI=1S/C7H9BrN2O2S/c1-4(6(11)12-2)9-7-10-5(8)3-13-7/h3-4H,1-2H3,(H,9,10)
InChIKeyPIQMEDPNZNJVJU-UHFFFAOYSA-N
MW265.13 g/mol
LogP1.88
Rot. Bonds3

About methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate

methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate (PubChem CID 79398752) has the molecular formula C7H9BrN2O2S and a molecular weight of 265.13 g/mol. Its IUPAC name is methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate.

Molecular Properties

Compound Namemethyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate
PubChem CID79398752
Molecular FormulaC7H9BrN2O2S
Molecular Weight265.13 g/mol
Exact Mass263.96
IUPAC Namemethyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate
SMILESCOC(=O)C(C)Nc1nc(Br)cs1
InChIInChI=1S/C7H9BrN2O2S/c1-4(6(11)12-2)9-7-10-5(8)3-13-7/h3-4H,1-2H3,(H,9,10)
InChIKeyPIQMEDPNZNJVJU-UHFFFAOYSA-N
XLogP1.88
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.13
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate?
The IUPAC name of methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate (CID 79398752) is methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate.
What is the SMILES notation for methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate?
The canonical SMILES for methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate is COC(=O)C(C)Nc1nc(Br)cs1.
What is the InChIKey of methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate?
The InChIKey is PIQMEDPNZNJVJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O2S/c1-4(6(11)12-2)9-7-10-5(8)3-13-7/h3-4H,1-2H3,(H,9,10).
What are the key properties of methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate?
methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate has a molecular weight of 265.13 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoate is sourced from PubChem (CID 79398752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).