2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid

C6H7BrN2O2S — CID 79399326

IUPAC2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid
SMILESCC(Nc1nc(Br)cs1)C(=O)O
InChIInChI=1S/C6H7BrN2O2S/c1-3(5(10)11)8-6-9-4(7)2-12-6/h2-3H,1H3,(H,8,9)(H,10,11)
InChIKeyNLWMAMABYVDLNW-UHFFFAOYSA-N
MW251.11 g/mol
LogP1.79
Rot. Bonds3

About 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid

2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 79399326) has the molecular formula C6H7BrN2O2S and a molecular weight of 251.11 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid.

Molecular Properties

Compound Name2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid
PubChem CID79399326
Molecular FormulaC6H7BrN2O2S
Molecular Weight251.11 g/mol
Exact Mass249.94
IUPAC Name2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid
SMILESCC(Nc1nc(Br)cs1)C(=O)O
InChIInChI=1S/C6H7BrN2O2S/c1-3(5(10)11)8-6-9-4(7)2-12-6/h2-3H,1H3,(H,8,9)(H,10,11)
InChIKeyNLWMAMABYVDLNW-UHFFFAOYSA-N
XLogP1.79
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.11
LogP ≤ 51.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid?
The IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid (CID 79399326) is 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid.
What is the SMILES notation for 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid?
The canonical SMILES for 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid is CC(Nc1nc(Br)cs1)C(=O)O.
What is the InChIKey of 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid?
The InChIKey is NLWMAMABYVDLNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2O2S/c1-3(5(10)11)8-6-9-4(7)2-12-6/h2-3H,1H3,(H,8,9)(H,10,11).
What are the key properties of 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid?
2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid has a molecular weight of 251.11 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-1,3-thiazol-2-yl)amino]propanoic acid is sourced from PubChem (CID 79399326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).