About 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid
2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid (PubChem CID 79399207) has the molecular formula C11H15BrN2O2S
and a molecular weight of 319.22 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid.
Molecular Properties
| Compound Name | 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid |
| PubChem CID | 79399207 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid |
| SMILES | O=C(O)C(Nc1nc(Br)cs1)C1CCCCC1 |
| InChI | InChI=1S/C11H15BrN2O2S/c12-8-6-17-11(13-8)14-9(10(15)16)7-4-2-1-3-5-7/h6-7,9H,1-5H2,(H,13,14)(H,15,16) |
| InChIKey | NVEKYIKFGBXSOG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid?
The IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid (CID 79399207) is 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid.
What is the SMILES notation for 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid?
The canonical SMILES for 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid is O=C(O)C(Nc1nc(Br)cs1)C1CCCCC1.
What is the InChIKey of 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid?
The InChIKey is NVEKYIKFGBXSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O2S/c12-8-6-17-11(13-8)14-9(10(15)16)7-4-2-1-3-5-7/h6-7,9H,1-5H2,(H,13,14)(H,15,16).
What are the key properties of 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid?
2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid has a molecular weight of 319.22 g/mol, XLogP of 3.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-cyclohexylacetic acid is sourced from PubChem (CID 79399207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).