C8H11N3O2S — CID 130855989
2-cyclobutyl-2-(1,3,4-thiadiazol-2-ylamino)acetic acid (PubChem CID 130855989) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-cyclobutyl-2-(1,3,4-thiadiazol-2-ylamino)acetic acid.
| Compound Name | 2-cyclobutyl-2-(1,3,4-thiadiazol-2-ylamino)acetic acid |
|---|---|
| PubChem CID | 130855989 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-cyclobutyl-2-(1,3,4-thiadiazol-2-ylamino)acetic acid |
| SMILES | O=C(O)C(Nc1nncs1)C1CCC1 |
| InChI | InChI=1S/C8H11N3O2S/c12-7(13)6(5-2-1-3-5)10-8-11-9-4-14-8/h4-6H,1-3H2,(H,10,11)(H,12,13) |
| InChIKey | JERQJGWVTPUFML-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |