C15H19N3S — CID 107648731
N-[cyclohexyl(phenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 107648731) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648731 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(C(Nc2nncs2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H19N3S/c1-3-7-12(8-4-1)14(13-9-5-2-6-10-13)17-15-18-16-11-19-15/h1,3-4,7-8,11,13-14H,2,5-6,9-10H2,(H,17,18) |
| InChIKey | RJMXHPAGKBIVML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |