C9H13BrN2O2S — CID 79806488
2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-ethylbutanoic acid (PubChem CID 79806488) has the molecular formula C9H13BrN2O2S and a molecular weight of 293.19 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-ethylbutanoic acid.
| Compound Name | 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79806488 |
| Molecular Formula | C9H13BrN2O2S |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-2-yl)amino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Nc1nc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C9H13BrN2O2S/c1-3-9(4-2,7(13)14)12-8-11-6(10)5-15-8/h5H,3-4H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | OMJSUZIJYCLRAM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |