C10H17BrN2S — CID 130692959
4-bromo-N-(2,3,3-trimethylbutan-2-yl)-1,3-thiazol-2-amine (PubChem CID 130692959) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 4-bromo-N-(2,3,3-trimethylbutan-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-(2,3,3-trimethylbutan-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130692959 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-bromo-N-(2,3,3-trimethylbutan-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)C(C)(C)Nc1nc(Br)cs1 |
| InChI | InChI=1S/C10H17BrN2S/c1-9(2,3)10(4,5)13-8-12-7(11)6-14-8/h6H,1-5H3,(H,12,13) |
| InChIKey | NULJIXIBCUDVBA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |