C9H15BrN2OS — CID 107153326
1-[(4-bromo-1,3-thiazol-2-yl)amino]-4-methylpentan-2-ol (PubChem CID 107153326) has the molecular formula C9H15BrN2OS and a molecular weight of 279.20 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-thiazol-2-yl)amino]-4-methylpentan-2-ol.
| Compound Name | 1-[(4-bromo-1,3-thiazol-2-yl)amino]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 107153326 |
| Molecular Formula | C9H15BrN2OS |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-[(4-bromo-1,3-thiazol-2-yl)amino]-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)CNc1nc(Br)cs1 |
| InChI | InChI=1S/C9H15BrN2OS/c1-6(2)3-7(13)4-11-9-12-8(10)5-14-9/h5-7,13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | AVQNOZCTLIQUDT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |