About 4-bromo-N-octyl-1,3-thiazol-2-amine
4-bromo-N-octyl-1,3-thiazol-2-amine (PubChem CID 115568968) has the molecular formula C11H19BrN2S
and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-bromo-N-octyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N-octyl-1,3-thiazol-2-amine |
| PubChem CID | 115568968 |
| Molecular Formula | C11H19BrN2S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-bromo-N-octyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCNc1nc(Br)cs1 |
| InChI | InChI=1S/C11H19BrN2S/c1-2-3-4-5-6-7-8-13-11-14-10(12)9-15-11/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | RWBBMPBTULYHGC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-octyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-octyl-1,3-thiazol-2-amine?
The IUPAC name of 4-bromo-N-octyl-1,3-thiazol-2-amine (CID 115568968) is 4-bromo-N-octyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-bromo-N-octyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-bromo-N-octyl-1,3-thiazol-2-amine is CCCCCCCCNc1nc(Br)cs1.
What is the InChIKey of 4-bromo-N-octyl-1,3-thiazol-2-amine?
The InChIKey is RWBBMPBTULYHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrN2S/c1-2-3-4-5-6-7-8-13-11-14-10(12)9-15-11/h9H,2-8H2,1H3,(H,13,14).
What are the key properties of 4-bromo-N-octyl-1,3-thiazol-2-amine?
4-bromo-N-octyl-1,3-thiazol-2-amine has a molecular weight of 291.26 g/mol, XLogP of 4.68, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-octyl-1,3-thiazol-2-amine is sourced from PubChem (CID 115568968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).