C11H19BrN2S — CID 115568968
4-bromo-N-octyl-1,3-thiazol-2-amine (PubChem CID 115568968) has the molecular formula C11H19BrN2S and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-bromo-N-octyl-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-octyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115568968 |
| Molecular Formula | C11H19BrN2S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-bromo-N-octyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCNc1nc(Br)cs1 |
| InChI | InChI=1S/C11H19BrN2S/c1-2-3-4-5-6-7-8-13-11-14-10(12)9-15-11/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | RWBBMPBTULYHGC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|