C12H13BrN2OS — CID 79400626
4-bromo-N-(3-phenoxypropyl)-1,3-thiazol-2-amine (PubChem CID 79400626) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 4-bromo-N-(3-phenoxypropyl)-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-(3-phenoxypropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79400626 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-bromo-N-(3-phenoxypropyl)-1,3-thiazol-2-amine |
| SMILES | Brc1csc(NCCCOc2ccccc2)n1 |
| InChI | InChI=1S/C12H13BrN2OS/c13-11-9-17-12(15-11)14-7-4-8-16-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,14,15) |
| InChIKey | YFZYGIIBJMWUTH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|