C18H19ClN2OS — CID 10315646
N-[3-(4-phenylphenoxy)propyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 10315646) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[3-(4-phenylphenoxy)propyl]-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | N-[3-(4-phenylphenoxy)propyl]-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 10315646 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[3-(4-phenylphenoxy)propyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(-c2ccc(OCCCNc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C18H18N2OS.ClH/c1-2-5-15(6-3-1)16-7-9-17(10-8-16)21-13-4-11-19-18-20-12-14-22-18;/h1-3,5-10,12,14H,4,11,13H2,(H,19,20);1H |
| InChIKey | UYBZGSAOFOHRDY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|