C14H16N4OS — CID 47164504
6-methyl-N-(3-phenoxypropyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 47164504) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 6-methyl-N-(3-phenoxypropyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-methyl-N-(3-phenoxypropyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 47164504 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 6-methyl-N-(3-phenoxypropyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | Cc1cn2nc(NCCCOc3ccccc3)sc2n1 |
| InChI | InChI=1S/C14H16N4OS/c1-11-10-18-14(16-11)20-13(17-18)15-8-5-9-19-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3,(H,15,17) |
| InChIKey | NLYZEZWTSKDKNM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|