C15H19N3O — CID 81131859
6-methyl-2-N-(3-phenoxypropyl)pyridine-2,3-diamine (PubChem CID 81131859) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 6-methyl-2-N-(3-phenoxypropyl)pyridine-2,3-diamine.
| Compound Name | 6-methyl-2-N-(3-phenoxypropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 81131859 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 6-methyl-2-N-(3-phenoxypropyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(NCCCOc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O/c1-12-8-9-14(16)15(18-12)17-10-5-11-19-13-6-3-2-4-7-13/h2-4,6-9H,5,10-11,16H2,1H3,(H,17,18) |
| InChIKey | BLFFJBQLUXDXHN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|