C11H19ClN2S — CID 107156261
N-(2-chloro-4-methylpentyl)-4-ethyl-1,3-thiazol-2-amine (PubChem CID 107156261) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is N-(2-chloro-4-methylpentyl)-4-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloro-4-methylpentyl)-4-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107156261 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(2-chloro-4-methylpentyl)-4-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCC(Cl)CC(C)C)n1 |
| InChI | InChI=1S/C11H19ClN2S/c1-4-10-7-15-11(14-10)13-6-9(12)5-8(2)3/h7-9H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | OQQKARZUOZJEIY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|