C9H17N3OS — CID 64541944
3-amino-4-[(4-ethyl-1,3-thiazol-2-yl)amino]butan-2-ol (PubChem CID 64541944) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-amino-4-[(4-ethyl-1,3-thiazol-2-yl)amino]butan-2-ol.
| Compound Name | 3-amino-4-[(4-ethyl-1,3-thiazol-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 64541944 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-amino-4-[(4-ethyl-1,3-thiazol-2-yl)amino]butan-2-ol |
| SMILES | CCc1csc(NCC(N)C(C)O)n1 |
| InChI | InChI=1S/C9H17N3OS/c1-3-7-5-14-9(12-7)11-4-8(10)6(2)13/h5-6,8,13H,3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | SGNFAADOIBZPCC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |