C11H18N2O2S — CID 65224618
2-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]pentanoic acid (PubChem CID 65224618) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]pentanoic acid.
| Compound Name | 2-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65224618 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[[(4-ethyl-1,3-thiazol-2-yl)amino]methyl]pentanoic acid |
| SMILES | CCCC(CNc1nc(CC)cs1)C(=O)O |
| InChI | InChI=1S/C11H18N2O2S/c1-3-5-8(10(14)15)6-12-11-13-9(4-2)7-16-11/h7-8H,3-6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | YMCQUFSNJRPCIU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |