C12H22ClN3S — CID 107156296
3-tert-butyl-N-(2-chloro-4-methylpentyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107156296) has the molecular formula C12H22ClN3S and a molecular weight of 275.85 g/mol. Its IUPAC name is 3-tert-butyl-N-(2-chloro-4-methylpentyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-(2-chloro-4-methylpentyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107156296 |
| Molecular Formula | C12H22ClN3S |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-tert-butyl-N-(2-chloro-4-methylpentyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)CC(Cl)CNc1nc(C(C)(C)C)ns1 |
| InChI | InChI=1S/C12H22ClN3S/c1-8(2)6-9(13)7-14-11-15-10(16-17-11)12(3,4)5/h8-9H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | FXZPRMPNXVIFKI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|