C10H17N3O2S — CID 65273610
2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butanoic acid (PubChem CID 65273610) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butanoic acid.
| Compound Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 65273610 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]butanoic acid |
| SMILES | CCC(Nc1nc(C(C)(C)C)ns1)C(=O)O |
| InChI | InChI=1S/C10H17N3O2S/c1-5-6(7(14)15)11-9-12-8(13-16-9)10(2,3)4/h6H,5H2,1-4H3,(H,14,15)(H,11,12,13) |
| InChIKey | ILBYHYDXRMJNSR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |