C11H17N3O2S — CID 122062834
(2S)-2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]hexanoic acid (PubChem CID 122062834) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is (2S)-2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122062834 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S)-2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1nc(C2CC2)ns1)C(=O)O |
| InChI | InChI=1S/C11H17N3O2S/c1-2-3-4-8(10(15)16)12-11-13-9(14-17-11)7-5-6-7/h7-8H,2-6H2,1H3,(H,15,16)(H,12,13,14)/t8-/m0/s1 |
| InChIKey | GLTNDOCZTJPFFX-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |