C10H12N2O2S — CID 131098912
2-(4-methylpent-1-yn-3-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 131098912) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(4-methylpent-1-yn-3-ylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(4-methylpent-1-yn-3-ylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 131098912 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(4-methylpent-1-yn-3-ylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | C#CC(Nc1nc(C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C10H12N2O2S/c1-4-7(6(2)3)11-10-12-8(5-15-10)9(13)14/h1,5-7H,2-3H3,(H,11,12)(H,13,14) |
| InChIKey | ZEJLHIHIMFOYPJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|