About 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid
2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 84761744) has the molecular formula C8H12N2O3S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid.
Analyze 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid (CID 84761744) is 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid is CCC(CO)Nc1nc(C(=O)O)cs1.
What is the InChIKey of 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is XBTIHRAPMPJWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c1-2-5(3-11)9-8-10-6(4-14-8)7(12)13/h4-5,11H,2-3H2,1H3,(H,9,10)(H,12,13).
What are the key properties of 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 216.26 g/mol, XLogP of 1.02, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxybutan-2-ylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 84761744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).