C8H11F3N2OS — CID 133365985
2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]butan-1-ol (PubChem CID 133365985) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]butan-1-ol.
| Compound Name | 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 133365985 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H11F3N2OS/c1-2-5(3-14)12-7-13-6(4-15-7)8(9,10)11/h4-5,14H,2-3H2,1H3,(H,12,13) |
| InChIKey | FQOKMUFPXFFELV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |