C10H14N2O4S — CID 116697189
2-(1-methoxybutan-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 116697189) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(1-methoxybutan-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(1-methoxybutan-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116697189 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(1-methoxybutan-2-ylcarbamoyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCC(COC)NC(=O)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H14N2O4S/c1-3-6(4-16-2)11-8(13)9-12-7(5-17-9)10(14)15/h5-6H,3-4H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | QDPHIDOFGNBSIN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |