2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid

C11H16N2O5S — CID 116696799

IUPAC2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid
SMILESCOCCN(CCOC)C(=O)c1nc(C(=O)O)cs1
InChIInChI=1S/C11H16N2O5S/c1-17-5-3-13(4-6-18-2)10(14)9-12-8(7-19-9)11(15)16/h7H,3-6H2,1-2H3,(H,15,16)
InChIKeyPTYGIVDEVZOXFL-UHFFFAOYSA-N
MW288.32 g/mol
LogP0.58
Rot. Bonds8

About 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid

2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 116696799) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid
PubChem CID116696799
Molecular FormulaC11H16N2O5S
Molecular Weight288.32 g/mol
Exact Mass288.08
IUPAC Name2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid
SMILESCOCCN(CCOC)C(=O)c1nc(C(=O)O)cs1
InChIInChI=1S/C11H16N2O5S/c1-17-5-3-13(4-6-18-2)10(14)9-12-8(7-19-9)11(15)16/h7H,3-6H2,1-2H3,(H,15,16)
InChIKeyPTYGIVDEVZOXFL-UHFFFAOYSA-N
XLogP0.58
TPSA88.96 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.32
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid (CID 116696799) is 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid is COCCN(CCOC)C(=O)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is PTYGIVDEVZOXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O5S/c1-17-5-3-13(4-6-18-2)10(14)9-12-8(7-19-9)11(15)16/h7H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid?
2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 288.32 g/mol, XLogP of 0.58, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-methoxyethyl)carbamoyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 116696799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).