C11H16N4OS — CID 113487734
6-methyl-N-(3-methylsulfinylpropyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 113487734) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-methyl-N-(3-methylsulfinylpropyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-methyl-N-(3-methylsulfinylpropyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 113487734 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 6-methyl-N-(3-methylsulfinylpropyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1ccc2nc(NCCCS(C)=O)nn2c1 |
| InChI | InChI=1S/C11H16N4OS/c1-9-4-5-10-13-11(14-15(10)8-9)12-6-3-7-17(2)16/h4-5,8H,3,6-7H2,1-2H3,(H,12,14) |
| InChIKey | OFBQGDISTIIGAB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|