C8H12N6OS — CID 115620446
N-(3-methylsulfinylpropyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 115620446) has the molecular formula C8H12N6OS and a molecular weight of 240.29 g/mol. Its IUPAC name is N-(3-methylsulfinylpropyl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(3-methylsulfinylpropyl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 115620446 |
| Molecular Formula | C8H12N6OS |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-(3-methylsulfinylpropyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CS(=O)CCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C8H12N6OS/c1-16(15)6-2-5-9-7-3-4-8-10-12-13-14(8)11-7/h3-4H,2,5-6H2,1H3,(H,9,11) |
| InChIKey | AYMFLNNDHIXRTD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|